C22H36N6O2 — CID 4134451
1-(2-cyanoethyl)-1-[2-[2-cyanoethyl(cyclohexylcarbamoyl)amino]ethyl]-3-cyclohexylurea (PubChem CID 4134451) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-[2-[2-cyanoethyl(cyclohexylcarbamoyl)amino]ethyl]-3-cyclohexylurea.
| Compound Name | 1-(2-cyanoethyl)-1-[2-[2-cyanoethyl(cyclohexylcarbamoyl)amino]ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 4134451 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-(2-cyanoethyl)-1-[2-[2-cyanoethyl(cyclohexylcarbamoyl)amino]ethyl]-3-cyclohexylurea |
| SMILES | N#CCCN(CCN(CCC#N)C(=O)NC1CCCCC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H36N6O2/c23-13-7-15-27(21(29)25-19-9-3-1-4-10-19)17-18-28(16-8-14-24)22(30)26-20-11-5-2-6-12-20/h19-20H,1-12,15-18H2,(H,25,29)(H,26,30) |
| InChIKey | SZRARLXMHCEYDQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |