C15H24N4O — CID 86910482
N,N-bis(2-cyanoethyl)-2-[cyclohexyl(methyl)amino]acetamide (PubChem CID 86910482) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-[cyclohexyl(methyl)amino]acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-[cyclohexyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 86910482 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-[cyclohexyl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)N(CCC#N)CCC#N)C1CCCCC1 |
| InChI | InChI=1S/C15H24N4O/c1-18(14-7-3-2-4-8-14)13-15(20)19(11-5-9-16)12-6-10-17/h14H,2-8,11-13H2,1H3 |
| InChIKey | CRZQKRUKUYSXCI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |