C21H28N4O2 — CID 60570471
N,N-bis(2-cyanoethyl)-2-[2-(4-methoxyphenyl)azepan-1-yl]acetamide (PubChem CID 60570471) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-[2-(4-methoxyphenyl)azepan-1-yl]acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-[2-(4-methoxyphenyl)azepan-1-yl]acetamide |
|---|---|
| PubChem CID | 60570471 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-[2-(4-methoxyphenyl)azepan-1-yl]acetamide |
| SMILES | COc1ccc(C2CCCCCN2CC(=O)N(CCC#N)CCC#N)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-27-19-10-8-18(9-11-19)20-7-3-2-4-14-25(20)17-21(26)24(15-5-12-22)16-6-13-23/h8-11,20H,2-7,14-17H2,1H3 |
| InChIKey | HVAOBWXOSXMZOS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |