C17H25N3O3S — CID 35317057
(2R)-N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-methylazepane-1-sulfonamide (PubChem CID 35317057) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is (2R)-N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-methylazepane-1-sulfonamide.
| Compound Name | (2R)-N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-methylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 35317057 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2R)-N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-methylazepane-1-sulfonamide |
| SMILES | COc1ccc([C@H]2CCCCCN2S(=O)(=O)N(C)CCC#N)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c1-19(13-6-12-18)24(21,22)20-14-5-3-4-7-17(20)15-8-10-16(23-2)11-9-15/h8-11,17H,3-7,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | GAUVAQDJKQSGBZ-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |