C21H34N2O2 — CID 174948159
N,N-dibutyl-2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 174948159) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N,N-dibutyl-2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N,N-dibutyl-2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 174948159 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N,N-dibutyl-2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | CCCCN(CCCC)C(=O)CN1CCCC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H34N2O2/c1-4-6-14-22(15-7-5-2)21(24)17-23-16-8-9-20(23)18-10-12-19(25-3)13-11-18/h10-13,20H,4-9,14-17H2,1-3H3 |
| InChIKey | MYPLQFGXMLVAKL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |