C22H25N3O — CID 51728114
N-(2-cyanoethyl)-2-[(2S)-2-(4-methylphenyl)pyrrolidin-1-yl]-N-phenylacetamide (PubChem CID 51728114) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[(2S)-2-(4-methylphenyl)pyrrolidin-1-yl]-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[(2S)-2-(4-methylphenyl)pyrrolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 51728114 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-(2-cyanoethyl)-2-[(2S)-2-(4-methylphenyl)pyrrolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc([C@@H]2CCCN2CC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-18-10-12-19(13-11-18)21-9-5-15-24(21)17-22(26)25(16-6-14-23)20-7-3-2-4-8-20/h2-4,7-8,10-13,21H,5-6,9,15-17H2,1H3/t21-/m0/s1 |
| InChIKey | AAJDVEFRWUBMQJ-NRFANRHFSA-N |
| XLogP | 4.08 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |