C19H27N3O — CID 127574650
3-(1-benzylpiperidin-4-yl)-1,1-bis(prop-2-enyl)urea (PubChem CID 127574650) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 127574650 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-3-12-22(13-4-2)19(23)20-18-10-14-21(15-11-18)16-17-8-6-5-7-9-17/h3-9,18H,1-2,10-16H2,(H,20,23) |
| InChIKey | UZKNRUHYZLVBAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|