C23H32N4O — CID 55457360
3-(1-benzylpiperidin-4-yl)-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea (PubChem CID 55457360) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 55457360 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O/c1-25(2)22-11-9-20(10-12-22)17-26(3)23(28)24-21-13-15-27(16-14-21)18-19-7-5-4-6-8-19/h4-12,21H,13-18H2,1-3H3,(H,24,28) |
| InChIKey | UYNUJKLJOVRFFB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|