2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid

C11H18N2O5S — CID 79285526

IUPAC2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid
SMILESC=CCN(CC(=O)O)C(=O)NC1CCCS(=O)(=O)C1
InChIInChI=1S/C11H18N2O5S/c1-2-5-13(7-10(14)15)11(16)12-9-4-3-6-19(17,18)8-9/h2,9H,1,3-8H2,(H,12,16)(H,14,15)
InChIKeyGKOIDBSPRZYIJZ-UHFFFAOYSA-N
MW290.34 g/mol
LogP-0.15
Rot. Bonds5

About 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid

2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 79285526) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid
PubChem CID79285526
Molecular FormulaC11H18N2O5S
Molecular Weight290.34 g/mol
Exact Mass290.09
IUPAC Name2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid
SMILESC=CCN(CC(=O)O)C(=O)NC1CCCS(=O)(=O)C1
InChIInChI=1S/C11H18N2O5S/c1-2-5-13(7-10(14)15)11(16)12-9-4-3-6-19(17,18)8-9/h2,9H,1,3-8H2,(H,12,16)(H,14,15)
InChIKeyGKOIDBSPRZYIJZ-UHFFFAOYSA-N
XLogP-0.15
TPSA103.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.34
LogP ≤ 5-0.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid?
The IUPAC name of 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid (CID 79285526) is 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid.
What is the SMILES notation for 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid?
The canonical SMILES for 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid is C=CCN(CC(=O)O)C(=O)NC1CCCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid?
The InChIKey is GKOIDBSPRZYIJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O5S/c1-2-5-13(7-10(14)15)11(16)12-9-4-3-6-19(17,18)8-9/h2,9H,1,3-8H2,(H,12,16)(H,14,15).
What are the key properties of 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid?
2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid has a molecular weight of 290.34 g/mol, XLogP of -0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothian-3-yl)carbamoyl-prop-2-enylamino]acetic acid is sourced from PubChem (CID 79285526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).