C10H18N2O5S — CID 61183235
3-[(1,1-dioxothiolan-3-yl)carbamoyl-ethylamino]propanoic acid (PubChem CID 61183235) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)carbamoyl-ethylamino]propanoic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)carbamoyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61183235 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)carbamoyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O5S/c1-2-12(5-3-9(13)14)10(15)11-8-4-6-18(16,17)7-8/h8H,2-7H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | ZZGUOTORCLAZDB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |