C10H16N2O3S — CID 94594481
3-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-1-prop-2-ynylurea (PubChem CID 94594481) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-1-prop-2-ynylurea.
| Compound Name | 3-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 94594481 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-1-prop-2-ynylurea |
| SMILES | C#CCN(CC)C(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O3S/c1-3-6-12(4-2)10(13)11-9-5-7-16(14,15)8-9/h1,9H,4-8H2,2H3,(H,11,13)/t9-/m1/s1 |
| InChIKey | HIRJBQMBJZEFRW-SECBINFHSA-N |
| XLogP | -0.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|