C13H24N2O3S — CID 47237189
1-cycloheptyl-3-(1,1-dioxothiolan-3-yl)-1-methylurea (PubChem CID 47237189) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-cycloheptyl-3-(1,1-dioxothiolan-3-yl)-1-methylurea.
| Compound Name | 1-cycloheptyl-3-(1,1-dioxothiolan-3-yl)-1-methylurea |
|---|---|
| PubChem CID | 47237189 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-cycloheptyl-3-(1,1-dioxothiolan-3-yl)-1-methylurea |
| SMILES | CN(C(=O)NC1CCS(=O)(=O)C1)C1CCCCCC1 |
| InChI | InChI=1S/C13H24N2O3S/c1-15(12-6-4-2-3-5-7-12)13(16)14-11-8-9-19(17,18)10-11/h11-12H,2-10H2,1H3,(H,14,16) |
| InChIKey | QFJLBIYAYKAVIS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |