C11H20N2O3S — CID 139000231
1-(cyclopropylmethyl)-3-(1,1-dioxothiolan-3-yl)-1-ethylurea (PubChem CID 139000231) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(1,1-dioxothiolan-3-yl)-1-ethylurea.
| Compound Name | 1-(cyclopropylmethyl)-3-(1,1-dioxothiolan-3-yl)-1-ethylurea |
|---|---|
| PubChem CID | 139000231 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(1,1-dioxothiolan-3-yl)-1-ethylurea |
| SMILES | CCN(CC1CC1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-2-13(7-9-3-4-9)11(14)12-10-5-6-17(15,16)8-10/h9-10H,2-8H2,1H3,(H,12,14) |
| InChIKey | YXCLXAPQHDKLSJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |