C12H22N2O5S — CID 61201639
3-[(1,1-dioxothian-4-yl)carbamoyl-propan-2-ylamino]propanoic acid (PubChem CID 61201639) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)carbamoyl-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[(1,1-dioxothian-4-yl)carbamoyl-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 61201639 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)carbamoyl-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H22N2O5S/c1-9(2)14(6-3-11(15)16)12(17)13-10-4-7-20(18,19)8-5-10/h9-10H,3-8H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | QNEDFZZKHLYKKS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |