C11H22N2O4S — CID 78977560
ethyl 2-[[methyl(propan-2-yl)sulfamoyl]-prop-2-enylamino]acetate (PubChem CID 78977560) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is ethyl 2-[[methyl(propan-2-yl)sulfamoyl]-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[[methyl(propan-2-yl)sulfamoyl]-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 78977560 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl 2-[[methyl(propan-2-yl)sulfamoyl]-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)S(=O)(=O)N(C)C(C)C |
| InChI | InChI=1S/C11H22N2O4S/c1-6-8-13(9-11(14)17-7-2)18(15,16)12(5)10(3)4/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | IOXDTYDWRACJGH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|