C13H24N2O5S — CID 115538843
ethyl 2-[prop-2-enyl-[2-(propylsulfonylamino)propanoyl]amino]acetate (PubChem CID 115538843) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 2-[prop-2-enyl-[2-(propylsulfonylamino)propanoyl]amino]acetate.
| Compound Name | ethyl 2-[prop-2-enyl-[2-(propylsulfonylamino)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 115538843 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 2-[prop-2-enyl-[2-(propylsulfonylamino)propanoyl]amino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)C(C)NS(=O)(=O)CCC |
| InChI | InChI=1S/C13H24N2O5S/c1-5-8-15(10-12(16)20-7-3)13(17)11(4)14-21(18,19)9-6-2/h5,11,14H,1,6-10H2,2-4H3 |
| InChIKey | GBLYANVESIVIOE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|