C13H26N2O5S — CID 61022871
ethyl 2-[propan-2-yl-[2-(propylsulfonylamino)propanoyl]amino]acetate (PubChem CID 61022871) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-[propan-2-yl-[2-(propylsulfonylamino)propanoyl]amino]acetate.
| Compound Name | ethyl 2-[propan-2-yl-[2-(propylsulfonylamino)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 61022871 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 2-[propan-2-yl-[2-(propylsulfonylamino)propanoyl]amino]acetate |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)N(CC(=O)OCC)C(C)C |
| InChI | InChI=1S/C13H26N2O5S/c1-6-8-21(18,19)14-11(5)13(17)15(10(3)4)9-12(16)20-7-2/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | RDPJFYDXIIOZHH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |