C11H24N2O4S — CID 43573547
N-(2-hydroxyethyl)-N-propan-2-yl-2-(propylsulfonylamino)propanamide (PubChem CID 43573547) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-propan-2-yl-2-(propylsulfonylamino)propanamide.
| Compound Name | N-(2-hydroxyethyl)-N-propan-2-yl-2-(propylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 43573547 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(2-hydroxyethyl)-N-propan-2-yl-2-(propylsulfonylamino)propanamide |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)N(CCO)C(C)C |
| InChI | InChI=1S/C11H24N2O4S/c1-5-8-18(16,17)12-10(4)11(15)13(6-7-14)9(2)3/h9-10,12,14H,5-8H2,1-4H3 |
| InChIKey | BSBIRZUTDBHZHM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |