C13H25N3O4 — CID 61021307
ethyl 2-[[2-(carbamoylamino)-3-methylbutanoyl]-propan-2-ylamino]acetate (PubChem CID 61021307) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 2-[[2-(carbamoylamino)-3-methylbutanoyl]-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[[2-(carbamoylamino)-3-methylbutanoyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 61021307 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | ethyl 2-[[2-(carbamoylamino)-3-methylbutanoyl]-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)C(NC(N)=O)C(C)C)C(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-6-20-10(17)7-16(9(4)5)12(18)11(8(2)3)15-13(14)19/h8-9,11H,6-7H2,1-5H3,(H3,14,15,19) |
| InChIKey | IZGSQTKBFHQVRM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |