C12H23N3O4 — CID 54898842
methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-ethylamino]propanoate (PubChem CID 54898842) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-ethylamino]propanoate.
| Compound Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-ethylamino]propanoate |
|---|---|
| PubChem CID | 54898842 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-ethylamino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)C(NC(N)=O)C(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-5-15(7-6-9(16)19-4)11(17)10(8(2)3)14-12(13)18/h8,10H,5-7H2,1-4H3,(H3,13,14,18) |
| InChIKey | JZNZIWXCXUXWIA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |