C11H21N3O4 — CID 54997524
methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]propanoate (PubChem CID 54997524) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]propanoate.
| Compound Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 54997524 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)C(NC(N)=O)C(C)C |
| InChI | InChI=1S/C11H21N3O4/c1-7(2)9(13-11(12)17)10(16)14(3)6-5-8(15)18-4/h7,9H,5-6H2,1-4H3,(H3,12,13,17) |
| InChIKey | MQAUEKFJOOGXLE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |