methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate

C10H19N3O4 — CID 54943017

IUPACmethyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C(=O)C(C)NC(N)=O
InChIInChI=1S/C10H19N3O4/c1-7(12-10(11)16)9(15)13(2)6-4-5-8(14)17-3/h7H,4-6H2,1-3H3,(H3,11,12,16)
InChIKeyZBATTZFAYKUNRI-UHFFFAOYSA-N
MW245.28 g/mol
LogP-0.55
Rot. Bonds6

About methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate

methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate (PubChem CID 54943017) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate.

Molecular Properties

Compound Namemethyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate
PubChem CID54943017
Molecular FormulaC10H19N3O4
Molecular Weight245.28 g/mol
Exact Mass245.14
IUPAC Namemethyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C(=O)C(C)NC(N)=O
InChIInChI=1S/C10H19N3O4/c1-7(12-10(11)16)9(15)13(2)6-4-5-8(14)17-3/h7H,4-6H2,1-3H3,(H3,11,12,16)
InChIKeyZBATTZFAYKUNRI-UHFFFAOYSA-N
XLogP-0.55
TPSA101.73 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 5-0.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate?
The IUPAC name of methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate (CID 54943017) is methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate.
What is the SMILES notation for methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate?
The canonical SMILES for methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate is COC(=O)CCCN(C)C(=O)C(C)NC(N)=O.
What is the InChIKey of methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate?
The InChIKey is ZBATTZFAYKUNRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O4/c1-7(12-10(11)16)9(15)13(2)6-4-5-8(14)17-3/h7H,4-6H2,1-3H3,(H3,11,12,16).
What are the key properties of methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate?
methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate has a molecular weight of 245.28 g/mol, XLogP of -0.55, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(carbamoylamino)propanoyl-methylamino]butanoate is sourced from PubChem (CID 54943017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).