C11H24N4O2 — CID 119658379
N-(3-amino-4-methylpentyl)-2-(carbamoylamino)-N-methylpropanamide (PubChem CID 119658379) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-2-(carbamoylamino)-N-methylpropanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-2-(carbamoylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 119658379 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-2-(carbamoylamino)-N-methylpropanamide |
| SMILES | CC(NC(N)=O)C(=O)N(C)CCC(N)C(C)C |
| InChI | InChI=1S/C11H24N4O2/c1-7(2)9(12)5-6-15(4)10(16)8(3)14-11(13)17/h7-9H,5-6,12H2,1-4H3,(H3,13,14,17) |
| InChIKey | FDYNJWFNOUPRDS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |