C11H23N3O2S — CID 119660546
2-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]sulfanylacetamide (PubChem CID 119660546) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]sulfanylacetamide.
| Compound Name | 2-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 119660546 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]sulfanylacetamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CSCC(N)=O |
| InChI | InChI=1S/C11H23N3O2S/c1-8(2)9(12)4-5-14(3)11(16)7-17-6-10(13)15/h8-9H,4-7,12H2,1-3H3,(H2,13,15) |
| InChIKey | WTKPFMSVAKBPFN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |