C14H26N4O3 — CID 119661461
N-(3-amino-4-methylpentyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-methylacetamide (PubChem CID 119661461) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-methylacetamide.
| Compound Name | N-(3-amino-4-methylpentyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 119661461 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-methylacetamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CN1C(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H26N4O3/c1-9(2)10(15)6-7-17(5)11(19)8-18-13(21)16-12(20)14(18,3)4/h9-10H,6-8,15H2,1-5H3,(H,16,20,21) |
| InChIKey | GQJDLPFIZKVMBD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|