C19H30ClN3O2 — CID 119661014
N-[1-[(3-amino-4-methylpentyl)-methylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 119661014) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[1-[(3-amino-4-methylpentyl)-methylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[(3-amino-4-methylpentyl)-methylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 119661014 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[1-[(3-amino-4-methylpentyl)-methylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)C(NC(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C19H30ClN3O2/c1-12(2)16(21)10-11-23(5)19(25)17(13(3)4)22-18(24)14-6-8-15(20)9-7-14/h6-9,12-13,16-17H,10-11,21H2,1-5H3,(H,22,24) |
| InChIKey | BYAKUSDREYAOOO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |