C14H22N4O2 — CID 95616247
(2R)-2-(carbamoylamino)-N-methyl-N-[2-(N-methylanilino)ethyl]propanamide (PubChem CID 95616247) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-methyl-N-[2-(N-methylanilino)ethyl]propanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-methyl-N-[2-(N-methylanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 95616247 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-methyl-N-[2-(N-methylanilino)ethyl]propanamide |
| SMILES | C[C@@H](NC(N)=O)C(=O)N(C)CCN(C)c1ccccc1 |
| InChI | InChI=1S/C14H22N4O2/c1-11(16-14(15)20)13(19)18(3)10-9-17(2)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H3,15,16,20)/t11-/m1/s1 |
| InChIKey | KGNNZJDNFVIFDU-LLVKDONJSA-N |
| XLogP | 0.64 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |