C10H21N3O3 — CID 107202680
2-(carbamoylamino)-N-(5-hydroxypentyl)-N-methylpropanamide (PubChem CID 107202680) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(5-hydroxypentyl)-N-methylpropanamide.
| Compound Name | 2-(carbamoylamino)-N-(5-hydroxypentyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 107202680 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(carbamoylamino)-N-(5-hydroxypentyl)-N-methylpropanamide |
| SMILES | CC(NC(N)=O)C(=O)N(C)CCCCCO |
| InChI | InChI=1S/C10H21N3O3/c1-8(12-10(11)16)9(15)13(2)6-4-3-5-7-14/h8,14H,3-7H2,1-2H3,(H3,11,12,16) |
| InChIKey | CMAUFQOHFUDLTI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|