C12H23NO4 — CID 107198553
4-[5-hydroxypentyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 107198553) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-[5-hydroxypentyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[5-hydroxypentyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107198553 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-[5-hydroxypentyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)N(C)CCCCCO |
| InChI | InChI=1S/C12H23NO4/c1-9(10(2)12(16)17)11(15)13(3)7-5-4-6-8-14/h9-10,14H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | PKNOTQZSGNMNSJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|