C11H20N4O2 — CID 107202215
N-(5-hydroxypentyl)-N-methyl-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 107202215) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N-methyl-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(5-hydroxypentyl)-N-methyl-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 107202215 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-(5-hydroxypentyl)-N-methyl-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)N(C)CCCCCO)n1cncn1 |
| InChI | InChI=1S/C11H20N4O2/c1-10(15-9-12-8-13-15)11(17)14(2)6-4-3-5-7-16/h8-10,16H,3-7H2,1-2H3 |
| InChIKey | BIFGBDJPFLRLNJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|