C17H25NO3 — CID 103497790
2,3-dimethyl-4-[methyl(4-phenylbutyl)amino]-4-oxobutanoic acid (PubChem CID 103497790) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2,3-dimethyl-4-[methyl(4-phenylbutyl)amino]-4-oxobutanoic acid.
| Compound Name | 2,3-dimethyl-4-[methyl(4-phenylbutyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103497790 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2,3-dimethyl-4-[methyl(4-phenylbutyl)amino]-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)N(C)CCCCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-13(14(2)17(20)21)16(19)18(3)12-8-7-11-15-9-5-4-6-10-15/h4-6,9-10,13-14H,7-8,11-12H2,1-3H3,(H,20,21) |
| InChIKey | AUEDXRKMJRIXRE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|