C14H27N5O3S — CID 119660888
N-(3-amino-4-methylpentyl)-N-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide (PubChem CID 119660888) has the molecular formula C14H27N5O3S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 119660888 |
| Molecular Formula | C14H27N5O3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1cnn(C)c1)C(=O)N(C)CCC(N)C(C)C |
| InChI | InChI=1S/C14H27N5O3S/c1-10(2)13(15)6-7-18(4)14(20)11(3)17-23(21,22)12-8-16-19(5)9-12/h8-11,13,17H,6-7,15H2,1-5H3 |
| InChIKey | JZIOIGHEHWBWNV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |