C13H20N4O5S — CID 122067240
2-[cyclopropyl-[2-[(1-methylpyrazol-4-yl)sulfonylamino]propanoyl]amino]propanoic acid (PubChem CID 122067240) has the molecular formula C13H20N4O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[(1-methylpyrazol-4-yl)sulfonylamino]propanoyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-[(1-methylpyrazol-4-yl)sulfonylamino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122067240 |
| Molecular Formula | C13H20N4O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[cyclopropyl-[2-[(1-methylpyrazol-4-yl)sulfonylamino]propanoyl]amino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1cnn(C)c1)C(=O)N(C1CC1)C(C)C(=O)O |
| InChI | InChI=1S/C13H20N4O5S/c1-8(15-23(21,22)11-6-14-16(3)7-11)12(18)17(10-4-5-10)9(2)13(19)20/h6-10,15H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | VPJMIJJVSSINJZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |