C10H17N3O4S — CID 61154150
(2S)-4-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]pentanoic acid (PubChem CID 61154150) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 61154150 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-4-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1cnn(C)c1)C(=O)O |
| InChI | InChI=1S/C10H17N3O4S/c1-7(2)4-9(10(14)15)12-18(16,17)8-5-11-13(3)6-8/h5-7,9,12H,4H2,1-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | UWCBRDIJTTYNAV-VIFPVBQESA-N |
| XLogP | 0.20 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |