C12H23N3O4 — CID 55008307
methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]-2-methylpropanoate (PubChem CID 55008307) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 55008307 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 3-[[2-(carbamoylamino)-3-methylbutanoyl]-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)C(=O)C(NC(N)=O)C(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-7(2)9(14-12(13)18)10(16)15(4)6-8(3)11(17)19-5/h7-9H,6H2,1-5H3,(H3,13,14,18) |
| InChIKey | IJWUEEGUNDULBO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |