C10H20N2O3 — CID 79024253
methyl 3-[[(2S)-2-aminobutanoyl]-methylamino]-2-methylpropanoate (PubChem CID 79024253) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-aminobutanoyl]-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[(2S)-2-aminobutanoyl]-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 79024253 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | methyl 3-[[(2S)-2-aminobutanoyl]-methylamino]-2-methylpropanoate |
| SMILES | CC[C@H](N)C(=O)N(C)CC(C)C(=O)OC |
| InChI | InChI=1S/C10H20N2O3/c1-5-8(11)9(13)12(3)6-7(2)10(14)15-4/h7-8H,5-6,11H2,1-4H3/t7?,8-/m0/s1 |
| InChIKey | ZUWCGJIWNYDMSA-MQWKRIRWSA-N |
| XLogP | -0.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |