C12H19NO2 — CID 84579166
3-ethyl-N,N-bis(prop-2-enyl)oxetane-3-carboxamide (PubChem CID 84579166) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-ethyl-N,N-bis(prop-2-enyl)oxetane-3-carboxamide.
| Compound Name | 3-ethyl-N,N-bis(prop-2-enyl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 84579166 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-ethyl-N,N-bis(prop-2-enyl)oxetane-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1(CC)COC1 |
| InChI | InChI=1S/C12H19NO2/c1-4-7-13(8-5-2)11(14)12(6-3)9-15-10-12/h4-5H,1-2,6-10H2,3H3 |
| InChIKey | HPYPZWSDJVCKKY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|