C15H20BrN3O3 — CID 9475595
4-bromo-N-[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide (PubChem CID 9475595) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is 4-bromo-N-[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9475595 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 4-bromo-N-[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)CNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrN3O3/c1-10(2)18-13(20)9-19(3)14(21)8-17-15(22)11-4-6-12(16)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,17,22)(H,18,20) |
| InChIKey | YHVRYHQHOZBAIA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |