C16H22BrN3O3 — CID 51193380
3-bromo-N-[2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide (PubChem CID 51193380) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is 3-bromo-N-[2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 51193380 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-bromo-N-[2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)CNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-4-20(10-14(21)19-11(2)3)15(22)9-18-16(23)12-6-5-7-13(17)8-12/h5-8,11H,4,9-10H2,1-3H3,(H,18,23)(H,19,21) |
| InChIKey | RZYFKGVSZNPQJY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |