C34H36N2O4 — CID 118271941
[4-(diphenylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-diphenylcarbamate (PubChem CID 118271941) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is [4-(diphenylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-diphenylcarbamate.
| Compound Name | [4-(diphenylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 118271941 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [4-(diphenylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-diphenylcarbamate |
| SMILES | CC(C)C(OC(=O)N(c1ccccc1)c1ccccc1)C(OC(=O)N(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C34H36N2O4/c1-25(2)31(39-33(37)35(27-17-9-5-10-18-27)28-19-11-6-12-20-28)32(26(3)4)40-34(38)36(29-21-13-7-14-22-29)30-23-15-8-16-24-30/h5-26,31-32H,1-4H3 |
| InChIKey | QFGWDOIPAMYADM-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |