About [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate
[4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate (PubChem CID 118272073) has the molecular formula C14H28N2O4
and a molecular weight of 288.39 g/mol. Its IUPAC name is [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate |
| PubChem CID | 118272073 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)C(OC(=O)N(C)C)C(OC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-9(2)11(19-13(17)15(5)6)12(10(3)4)20-14(18)16(7)8/h9-12H,1-8H3 |
| InChIKey | ZWQUXYYYEHGEHV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate?
The IUPAC name of [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate (CID 118272073) is [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate?
The canonical SMILES for [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate is CC(C)C(OC(=O)N(C)C)C(OC(=O)N(C)C)C(C)C.
What is the InChIKey of [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate?
The InChIKey is ZWQUXYYYEHGEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O4/c1-9(2)11(19-13(17)15(5)6)12(10(3)4)20-14(18)16(7)8/h9-12H,1-8H3.
What are the key properties of [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate?
[4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate has a molecular weight of 288.39 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylcarbamoyloxy)-2,5-dimethylhexan-3-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 118272073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).