C13H27NO4 — CID 23346607
(4-tert-butylperoxy-4-methylpentan-2-yl) N,N-dimethylcarbamate (PubChem CID 23346607) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is (4-tert-butylperoxy-4-methylpentan-2-yl) N,N-dimethylcarbamate.
| Compound Name | (4-tert-butylperoxy-4-methylpentan-2-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 23346607 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (4-tert-butylperoxy-4-methylpentan-2-yl) N,N-dimethylcarbamate |
| SMILES | CC(CC(C)(C)OOC(C)(C)C)OC(=O)N(C)C |
| InChI | InChI=1S/C13H27NO4/c1-10(16-11(15)14(7)8)9-13(5,6)18-17-12(2,3)4/h10H,9H2,1-8H3 |
| InChIKey | SUCCBPGZGSYEIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|