C27H41NO6 — CID 175543117
[(4-tert-butylperoxy-4-methylpentan-2-yl)oxycarbonyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]amino] 2-methylprop-2-enoate (PubChem CID 175543117) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is [(4-tert-butylperoxy-4-methylpentan-2-yl)oxycarbonyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]amino] 2-methylprop-2-enoate.
| Compound Name | [(4-tert-butylperoxy-4-methylpentan-2-yl)oxycarbonyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]amino] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175543117 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [(4-tert-butylperoxy-4-methylpentan-2-yl)oxycarbonyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]amino] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ON(C(=O)OC(C)CC(C)(C)OOC(C)(C)C)C(C)(C)c1cccc(C(=C)C)c1 |
| InChI | InChI=1S/C27H41NO6/c1-18(2)21-14-13-15-22(16-21)27(11,12)28(32-23(29)19(3)4)24(30)31-20(5)17-26(9,10)34-33-25(6,7)8/h13-16,20H,1,3,17H2,2,4-12H3 |
| InChIKey | VDLKKLAGYYSGMY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|