C19H25NO4 — CID 54099943
2-(2-methylprop-2-enoyloxy)ethyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamic acid (PubChem CID 54099943) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamic acid.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 54099943 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamic acid |
| SMILES | C=C(C)C(=O)OCCN(C(=O)O)C(C)(C)c1cccc(C(=C)C)c1 |
| InChI | InChI=1S/C19H25NO4/c1-13(2)15-8-7-9-16(12-15)19(5,6)20(18(22)23)10-11-24-17(21)14(3)4/h7-9,12H,1,3,10-11H2,2,4-6H3,(H,22,23) |
| InChIKey | MZVVMMBLBJRBFN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|