C24H37NO4 — CID 154640881
[4-methyl-4-(2-methylbutan-2-ylperoxy)pentan-2-yl] N-[(E)-1-(3-prop-1-en-2-ylphenyl)prop-1-en-2-yl]carbamate (PubChem CID 154640881) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is [4-methyl-4-(2-methylbutan-2-ylperoxy)pentan-2-yl] N-[(E)-1-(3-prop-1-en-2-ylphenyl)prop-1-en-2-yl]carbamate.
| Compound Name | [4-methyl-4-(2-methylbutan-2-ylperoxy)pentan-2-yl] N-[(E)-1-(3-prop-1-en-2-ylphenyl)prop-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 154640881 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | [4-methyl-4-(2-methylbutan-2-ylperoxy)pentan-2-yl] N-[(E)-1-(3-prop-1-en-2-ylphenyl)prop-1-en-2-yl]carbamate |
| SMILES | C=C(C)c1cccc(/C=C(\C)NC(=O)OC(C)CC(C)(C)OOC(C)(C)CC)c1 |
| InChI | InChI=1S/C24H37NO4/c1-10-23(6,7)28-29-24(8,9)16-19(5)27-22(26)25-18(4)14-20-12-11-13-21(15-20)17(2)3/h11-15,19H,2,10,16H2,1,3-9H3,(H,25,26)/b18-14+ |
| InChIKey | CWXPWYIJWZZWIM-NBVRZTHBSA-N |
| XLogP | 6.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|