C10H19NO4 — CID 126560988
2-(dimethylcarbamoyloxy)-2,4-dimethylpentanoic acid (PubChem CID 126560988) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-(dimethylcarbamoyloxy)-2,4-dimethylpentanoic acid.
| Compound Name | 2-(dimethylcarbamoyloxy)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 126560988 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-(dimethylcarbamoyloxy)-2,4-dimethylpentanoic acid |
| SMILES | CC(C)CC(C)(OC(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-7(2)6-10(3,8(12)13)15-9(14)11(4)5/h7H,6H2,1-5H3,(H,12,13) |
| InChIKey | OTBPPMXVWFFGDK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |