About (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate
(4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate (PubChem CID 54132789) has the molecular formula C15H27ClO5
and a molecular weight of 322.83 g/mol. Its IUPAC name is (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate.
Molecular Properties
| Compound Name | (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate |
| PubChem CID | 54132789 |
| Molecular Formula | C15H27ClO5 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate |
| SMILES | CCCCC(CC)C(=O)OOC(C)(C)CC(C)OC(=O)Cl |
| InChI | InChI=1S/C15H27ClO5/c1-6-8-9-12(7-2)13(17)20-21-15(4,5)10-11(3)19-14(16)18/h11-12H,6-10H2,1-5H3 |
| InChIKey | NVNNCTXXGIJAEI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The IUPAC name of (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate (CID 54132789) is (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate.
What is the SMILES notation for (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The canonical SMILES for (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate is CCCCC(CC)C(=O)OOC(C)(C)CC(C)OC(=O)Cl.
What is the InChIKey of (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The InChIKey is NVNNCTXXGIJAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27ClO5/c1-6-8-9-12(7-2)13(17)20-21-15(4,5)10-11(3)19-14(16)18/h11-12H,6-10H2,1-5H3.
What are the key properties of (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate?
(4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate has a molecular weight of 322.83 g/mol, XLogP of 4.61, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbonochloridoyloxy-2-methylpentan-2-yl) 2-ethylhexaneperoxoate is sourced from PubChem (CID 54132789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).