About (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate
(2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate (PubChem CID 139926955) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate.
Molecular Properties
| Compound Name | (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate |
| PubChem CID | 139926955 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate |
| SMILES | CCCCC(CC)C(=O)OOC(C)(O)CC(C)C |
| InChI | InChI=1S/C14H28O4/c1-6-8-9-12(7-2)13(15)17-18-14(5,16)10-11(3)4/h11-12,16H,6-10H2,1-5H3 |
| InChIKey | ACOFTHQZMUARGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The IUPAC name of (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate (CID 139926955) is (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate.
What is the SMILES notation for (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The canonical SMILES for (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate is CCCCC(CC)C(=O)OOC(C)(O)CC(C)C.
What is the InChIKey of (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate?
The InChIKey is ACOFTHQZMUARGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4/c1-6-8-9-12(7-2)13(15)17-18-14(5,16)10-11(3)4/h11-12,16H,6-10H2,1-5H3.
What are the key properties of (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate?
(2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate has a molecular weight of 260.37 g/mol, XLogP of 3.43, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4-methylpentan-2-yl) 2-ethylhexaneperoxoate is sourced from PubChem (CID 139926955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).