About 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate
2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate (PubChem CID 54330811) has the molecular formula C20H38O6
and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate.
Molecular Properties
| Compound Name | 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate |
| PubChem CID | 54330811 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate |
| SMILES | CCCCC(CC)C(=O)OOOOC(=O)C(CC)(CCCC)CC(C)C |
| InChI | InChI=1S/C20H38O6/c1-7-11-13-17(9-3)18(21)23-25-26-24-19(22)20(10-4,14-12-8-2)15-16(5)6/h16-17H,7-15H2,1-6H3 |
| InChIKey | SYFFKMXIIZYEBH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate?
The IUPAC name of 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate (CID 54330811) is 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate.
What is the SMILES notation for 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate?
The canonical SMILES for 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate is CCCCC(CC)C(=O)OOOOC(=O)C(CC)(CCCC)CC(C)C.
What is the InChIKey of 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate?
The InChIKey is SYFFKMXIIZYEBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O6/c1-7-11-13-17(9-3)18(21)23-25-26-24-19(22)20(10-4,14-12-8-2)15-16(5)6/h16-17H,7-15H2,1-6H3.
What are the key properties of 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate?
2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate has a molecular weight of 374.52 g/mol, XLogP of 5.70, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoylperoxy 2-ethyl-2-(2-methylpropyl)hexaneperoxoate is sourced from PubChem (CID 54330811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).