C23H44O4 — CID 139749095
[5-(2-ethylhexanoyloxy)-2,4-dimethylpentyl] 2-ethylhexanoate (PubChem CID 139749095) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is [5-(2-ethylhexanoyloxy)-2,4-dimethylpentyl] 2-ethylhexanoate.
| Compound Name | [5-(2-ethylhexanoyloxy)-2,4-dimethylpentyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 139749095 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | [5-(2-ethylhexanoyloxy)-2,4-dimethylpentyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC(C)CC(C)COC(=O)C(CC)CCCC |
| InChI | InChI=1S/C23H44O4/c1-7-11-13-20(9-3)22(24)26-16-18(5)15-19(6)17-27-23(25)21(10-4)14-12-8-2/h18-21H,7-17H2,1-6H3 |
| InChIKey | RPWMIQMZCBITMT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |